C5H10F2N2 — CID 105265234
(1,1-difluoro-3-methylbut-3-en-2-yl)hydrazine (PubChem CID 105265234) has the molecular formula C5H10F2N2 and a molecular weight of 136.14 g/mol. Its IUPAC name is (1,1-difluoro-3-methylbut-3-en-2-yl)hydrazine.
| Compound Name | (1,1-difluoro-3-methylbut-3-en-2-yl)hydrazine |
|---|---|
| PubChem CID | 105265234 |
| Molecular Formula | C5H10F2N2 |
| Molecular Weight | 136.14 g/mol |
| Exact Mass | 136.08 |
| IUPAC Name | (1,1-difluoro-3-methylbut-3-en-2-yl)hydrazine |
| SMILES | C=C(C)C(NN)C(F)F |
| InChI | InChI=1S/C5H10F2N2/c1-3(2)4(9-8)5(6)7/h4-5,9H,1,8H2,2H3 |
| InChIKey | YWGAXENPWHIFCZ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.14 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|