C6H8F2N4 — CID 105265240
(2,2-difluoro-1-pyrazin-2-ylethyl)hydrazine (PubChem CID 105265240) has the molecular formula C6H8F2N4 and a molecular weight of 174.15 g/mol. Its IUPAC name is (2,2-difluoro-1-pyrazin-2-ylethyl)hydrazine.
| Compound Name | (2,2-difluoro-1-pyrazin-2-ylethyl)hydrazine |
|---|---|
| PubChem CID | 105265240 |
| Molecular Formula | C6H8F2N4 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | (2,2-difluoro-1-pyrazin-2-ylethyl)hydrazine |
| SMILES | NNC(c1cnccn1)C(F)F |
| InChI | InChI=1S/C6H8F2N4/c7-6(8)5(12-9)4-3-10-1-2-11-4/h1-3,5-6,12H,9H2 |
| InChIKey | NUAAHSAILCCUHY-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|