C25H32O6 — CID 10526557
[(1S,2S,3S,4R)-3-[(1E,3E)-5-(3-formyl-2,6-dihydroxy-4-methylphenyl)-3-methylpenta-1,3-dienyl]-2,3,4-trimethyl-5-oxocyclohexyl] acetate (PubChem CID 10526557) has the molecular formula C25H32O6 and a molecular weight of 428.53 g/mol. Its IUPAC name is [(1S,2S,3S,4R)-3-[(1E,3E)-5-(3-formyl-2,6-dihydroxy-4-methylphenyl)-3-methylpenta-1,3-dienyl]-2,3,4-trimethyl-5-oxocyclohexyl] acetate.
| Compound Name | [(1S,2S,3S,4R)-3-[(1E,3E)-5-(3-formyl-2,6-dihydroxy-4-methylphenyl)-3-methylpenta-1,3-dienyl]-2,3,4-trimethyl-5-oxocyclohexyl] acetate |
|---|---|
| PubChem CID | 10526557 |
| Molecular Formula | C25H32O6 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | [(1S,2S,3S,4R)-3-[(1E,3E)-5-(3-formyl-2,6-dihydroxy-4-methylphenyl)-3-methylpenta-1,3-dienyl]-2,3,4-trimethyl-5-oxocyclohexyl] acetate |
| SMILES | CC(=O)O[C@H]1CC(=O)[C@H](C)[C@@](C)(/C=C/C(C)=C/Cc2c(O)cc(C)c(C=O)c2O)[C@@H]1C |
| InChI | InChI=1S/C25H32O6/c1-14(7-8-19-22(29)11-15(2)20(13-26)24(19)30)9-10-25(6)16(3)21(28)12-23(17(25)4)31-18(5)27/h7,9-11,13,16-17,23,29-30H,8,12H2,1-6H3/b10-9+,14-7+/t16-,17+,23-,25+/m0/s1 |
| InChIKey | VSWRRSKSGIQJKK-CADSEURFSA-N |
| XLogP | 4.45 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|