C12H25N3O — CID 105265763
[2-ethoxy-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethyl]hydrazine (PubChem CID 105265763) has the molecular formula C12H25N3O and a molecular weight of 227.35 g/mol. Its IUPAC name is [2-ethoxy-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethyl]hydrazine.
| Compound Name | [2-ethoxy-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105265763 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | [2-ethoxy-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethyl]hydrazine |
| SMILES | CCOCC(NN)C1CC2CCC(C1)N2C |
| InChI | InChI=1S/C12H25N3O/c1-3-16-8-12(14-13)9-6-10-4-5-11(7-9)15(10)2/h9-12,14H,3-8,13H2,1-2H3 |
| InChIKey | SZISEPHWQTYLLT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|