C15H23BrN4 — CID 105265764
[2-(5-bromo-2-pyridinyl)-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethyl]hydrazine (PubChem CID 105265764) has the molecular formula C15H23BrN4 and a molecular weight of 339.28 g/mol. Its IUPAC name is [2-(5-bromo-2-pyridinyl)-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethyl]hydrazine.
| Compound Name | [2-(5-bromo-2-pyridinyl)-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105265764 |
| Molecular Formula | C15H23BrN4 |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | [2-(5-bromo-2-pyridinyl)-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethyl]hydrazine |
| SMILES | CN1C2CCC1CC(C(Cc1ccc(Br)cn1)NN)C2 |
| InChI | InChI=1S/C15H23BrN4/c1-20-13-4-5-14(20)7-10(6-13)15(19-17)8-12-3-2-11(16)9-18-12/h2-3,9-10,13-15,19H,4-8,17H2,1H3 |
| InChIKey | NSGBVVKQAQSXGW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|