C17H26FN3 — CID 105265865
[2-(4-fluoro-2-methylphenyl)-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethyl]hydrazine (PubChem CID 105265865) has the molecular formula C17H26FN3 and a molecular weight of 291.41 g/mol. Its IUPAC name is [2-(4-fluoro-2-methylphenyl)-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethyl]hydrazine.
| Compound Name | [2-(4-fluoro-2-methylphenyl)-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105265865 |
| Molecular Formula | C17H26FN3 |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | [2-(4-fluoro-2-methylphenyl)-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethyl]hydrazine |
| SMILES | Cc1cc(F)ccc1CC(NN)C1CC2CCC(C1)N2C |
| InChI | InChI=1S/C17H26FN3/c1-11-7-14(18)4-3-12(11)10-17(20-19)13-8-15-5-6-16(9-13)21(15)2/h3-4,7,13,15-17,20H,5-6,8-10,19H2,1-2H3 |
| InChIKey | YZRYDQHDZKPCMH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|