C19H21N5O5S — CID 10526668
(2R)-2-[[4-[2-(4-methoxyphenyl)tetrazol-5-yl]phenyl]sulfonylamino]-3-methylbutanoic acid (PubChem CID 10526668) has the molecular formula C19H21N5O5S and a molecular weight of 431.47 g/mol. Its IUPAC name is (2R)-2-[[4-[2-(4-methoxyphenyl)tetrazol-5-yl]phenyl]sulfonylamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[4-[2-(4-methoxyphenyl)tetrazol-5-yl]phenyl]sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 10526668 |
| Molecular Formula | C19H21N5O5S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | (2R)-2-[[4-[2-(4-methoxyphenyl)tetrazol-5-yl]phenyl]sulfonylamino]-3-methylbutanoic acid |
| SMILES | COc1ccc(-n2nnc(-c3ccc(S(=O)(=O)N[C@@H](C(=O)O)C(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C19H21N5O5S/c1-12(2)17(19(25)26)22-30(27,28)16-10-4-13(5-11-16)18-20-23-24(21-18)14-6-8-15(29-3)9-7-14/h4-12,17,22H,1-3H3,(H,25,26)/t17-/m1/s1 |
| InChIKey | WOHFFTZCAUWMET-QGZVFWFLSA-N |
| XLogP | 1.73 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |