C16H23N3O7S2 — CID 10526788
(2R,4S)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-hydroxy-1-(4-methoxyphenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 10526788) has the molecular formula C16H23N3O7S2 and a molecular weight of 433.51 g/mol. Its IUPAC name is (2R,4S)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-hydroxy-1-(4-methoxyphenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-hydroxy-1-(4-methoxyphenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10526788 |
| Molecular Formula | C16H23N3O7S2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | (2R,4S)-4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-hydroxy-1-(4-methoxyphenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2C[C@@H](N3CCS(=O)(=O)CC3)C[C@@H]2C(=O)NO)cc1 |
| InChI | InChI=1S/C16H23N3O7S2/c1-26-13-2-4-14(5-3-13)28(24,25)19-11-12(10-15(19)16(20)17-21)18-6-8-27(22,23)9-7-18/h2-5,12,15,21H,6-11H2,1H3,(H,17,20)/t12-,15+/m0/s1 |
| InChIKey | HZELUBQHAZKZKC-SWLSCSKDSA-N |
| XLogP | -0.94 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|