C11H12BrN5 — CID 105268078
3-[(3-bromo-2-pyridinyl)-hydrazinylmethyl]pyridin-2-amine (PubChem CID 105268078) has the molecular formula C11H12BrN5 and a molecular weight of 294.16 g/mol. Its IUPAC name is 3-[(3-bromo-2-pyridinyl)-hydrazinylmethyl]pyridin-2-amine.
| Compound Name | 3-[(3-bromo-2-pyridinyl)-hydrazinylmethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 105268078 |
| Molecular Formula | C11H12BrN5 |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 3-[(3-bromo-2-pyridinyl)-hydrazinylmethyl]pyridin-2-amine |
| SMILES | NNC(c1cccnc1N)c1ncccc1Br |
| InChI | InChI=1S/C11H12BrN5/c12-8-4-2-5-15-10(8)9(17-14)7-3-1-6-16-11(7)13/h1-6,9,17H,14H2,(H2,13,16) |
| InChIKey | XPYVILZLZJYJGU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|