C14H19ClN2 — CID 105270128
[1-(3-chlorophenyl)-2-(cyclohexen-1-yl)ethyl]hydrazine (PubChem CID 105270128) has the molecular formula C14H19ClN2 and a molecular weight of 250.77 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-2-(cyclohexen-1-yl)ethyl]hydrazine.
| Compound Name | [1-(3-chlorophenyl)-2-(cyclohexen-1-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105270128 |
| Molecular Formula | C14H19ClN2 |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | [1-(3-chlorophenyl)-2-(cyclohexen-1-yl)ethyl]hydrazine |
| SMILES | NNC(CC1=CCCCC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H19ClN2/c15-13-8-4-7-12(10-13)14(17-16)9-11-5-2-1-3-6-11/h4-5,7-8,10,14,17H,1-3,6,9,16H2 |
| InChIKey | JXLCAEGTZYXJDM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|