C18H19ClN4O3S2 — CID 10527022
(3R)-3-(2-chloroethylcarbamoylamino)-4-oxo-5-(thiophen-3-ylmethyl)-2,3-dihydro-1,5-benzothiazepine-7-carboxamide (PubChem CID 10527022) has the molecular formula C18H19ClN4O3S2 and a molecular weight of 438.96 g/mol. Its IUPAC name is (3R)-3-(2-chloroethylcarbamoylamino)-4-oxo-5-(thiophen-3-ylmethyl)-2,3-dihydro-1,5-benzothiazepine-7-carboxamide.
| Compound Name | (3R)-3-(2-chloroethylcarbamoylamino)-4-oxo-5-(thiophen-3-ylmethyl)-2,3-dihydro-1,5-benzothiazepine-7-carboxamide |
|---|---|
| PubChem CID | 10527022 |
| Molecular Formula | C18H19ClN4O3S2 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | (3R)-3-(2-chloroethylcarbamoylamino)-4-oxo-5-(thiophen-3-ylmethyl)-2,3-dihydro-1,5-benzothiazepine-7-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)N(Cc1ccsc1)C(=O)[C@@H](NC(=O)NCCCl)CS2 |
| InChI | InChI=1S/C18H19ClN4O3S2/c19-4-5-21-18(26)22-13-10-28-15-2-1-12(16(20)24)7-14(15)23(17(13)25)8-11-3-6-27-9-11/h1-3,6-7,9,13H,4-5,8,10H2,(H2,20,24)(H2,21,22,26)/t13-/m0/s1 |
| InChIKey | KYMLBJHWYWXBSB-ZDUSSCGKSA-N |
| XLogP | 2.39 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|