C13H28N2O2 — CID 105270810
[2-methoxy-1-(2,2,5,5-tetramethyloxolan-3-yl)butyl]hydrazine (PubChem CID 105270810) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is [2-methoxy-1-(2,2,5,5-tetramethyloxolan-3-yl)butyl]hydrazine.
| Compound Name | [2-methoxy-1-(2,2,5,5-tetramethyloxolan-3-yl)butyl]hydrazine |
|---|---|
| PubChem CID | 105270810 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | [2-methoxy-1-(2,2,5,5-tetramethyloxolan-3-yl)butyl]hydrazine |
| SMILES | CCC(OC)C(NN)C1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C13H28N2O2/c1-7-10(16-6)11(15-14)9-8-12(2,3)17-13(9,4)5/h9-11,15H,7-8,14H2,1-6H3 |
| InChIKey | IUNQRCDOOQPZPB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|