C26H33N5O2 — CID 1052711
2-[benzylcarbamoyl(propyl)amino]-N-(3-tert-butyl-1-phenylpyrazol-5-yl)acetamide (PubChem CID 1052711) has the molecular formula C26H33N5O2 and a molecular weight of 447.58 g/mol. Its IUPAC name is 2-[benzylcarbamoyl(propyl)amino]-N-(3-tert-butyl-1-phenylpyrazol-5-yl)acetamide.
| Compound Name | 2-[benzylcarbamoyl(propyl)amino]-N-(3-tert-butyl-1-phenylpyrazol-5-yl)acetamide |
|---|---|
| PubChem CID | 1052711 |
| Molecular Formula | C26H33N5O2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | 2-[benzylcarbamoyl(propyl)amino]-N-(3-tert-butyl-1-phenylpyrazol-5-yl)acetamide |
| SMILES | CCCN(CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccccc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C26H33N5O2/c1-5-16-30(25(33)27-18-20-12-8-6-9-13-20)19-24(32)28-23-17-22(26(2,3)4)29-31(23)21-14-10-7-11-15-21/h6-15,17H,5,16,18-19H2,1-4H3,(H,27,33)(H,28,32) |
| InChIKey | SIUKVJIXCVKILI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |