C16H28N2O3 — CID 105271536
[2-ethoxy-1-[2-(2-methoxyethoxy)phenyl]pentyl]hydrazine (PubChem CID 105271536) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is [2-ethoxy-1-[2-(2-methoxyethoxy)phenyl]pentyl]hydrazine.
| Compound Name | [2-ethoxy-1-[2-(2-methoxyethoxy)phenyl]pentyl]hydrazine |
|---|---|
| PubChem CID | 105271536 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | [2-ethoxy-1-[2-(2-methoxyethoxy)phenyl]pentyl]hydrazine |
| SMILES | CCCC(OCC)C(NN)c1ccccc1OCCOC |
| InChI | InChI=1S/C16H28N2O3/c1-4-8-15(20-5-2)16(18-17)13-9-6-7-10-14(13)21-12-11-19-3/h6-7,9-10,15-16,18H,4-5,8,11-12,17H2,1-3H3 |
| InChIKey | HRHQICQGNPPHJQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|