C23H22O9 — CID 10527165
dimethyl (1S,11S,12R,13S)-1-(3,4-dimethoxyphenyl)-5,7,14-trioxatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4(8),9-triene-12,13-dicarboxylate (PubChem CID 10527165) has the molecular formula C23H22O9 and a molecular weight of 442.42 g/mol. Its IUPAC name is dimethyl (1S,11S,12R,13S)-1-(3,4-dimethoxyphenyl)-5,7,14-trioxatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4(8),9-triene-12,13-dicarboxylate.
| Compound Name | dimethyl (1S,11S,12R,13S)-1-(3,4-dimethoxyphenyl)-5,7,14-trioxatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4(8),9-triene-12,13-dicarboxylate |
|---|---|
| PubChem CID | 10527165 |
| Molecular Formula | C23H22O9 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | dimethyl (1S,11S,12R,13S)-1-(3,4-dimethoxyphenyl)-5,7,14-trioxatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4(8),9-triene-12,13-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@@H]2O[C@@](c3ccc(OC)c(OC)c3)(c3cc4c(cc32)OCO4)[C@H]1C(=O)OC |
| InChI | InChI=1S/C23H22O9/c1-26-14-6-5-11(7-15(14)27-2)23-13-9-17-16(30-10-31-17)8-12(13)20(32-23)18(21(24)28-3)19(23)22(25)29-4/h5-9,18-20H,10H2,1-4H3/t18-,19-,20-,23+/m1/s1 |
| InChIKey | GDXJOMYLUHZYAY-URFJDIBFSA-N |
| XLogP | 2.34 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |