C21H20N2O4Se — CID 10527220
5,7-bis(4-methoxyphenyl)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazole-6-carboxylic acid (PubChem CID 10527220) has the molecular formula C21H20N2O4Se and a molecular weight of 443.36 g/mol. Its IUPAC name is 5,7-bis(4-methoxyphenyl)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazole-6-carboxylic acid.
| Compound Name | 5,7-bis(4-methoxyphenyl)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 10527220 |
| Molecular Formula | C21H20N2O4Se |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 5,7-bis(4-methoxyphenyl)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazole-6-carboxylic acid |
| SMILES | COc1ccc(C2Cc3nn[se]c3C(c3ccc(OC)cc3)C2C(=O)O)cc1 |
| InChI | InChI=1S/C21H20N2O4Se/c1-26-14-7-3-12(4-8-14)16-11-17-20(28-23-22-17)18(19(16)21(24)25)13-5-9-15(27-2)10-6-13/h3-10,16,18-19H,11H2,1-2H3,(H,24,25) |
| InChIKey | QQSPRUPTMWFEBU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|