C24H20N4O3S — CID 10527264
5-[[4-[(3-methyl-5-phenylimidazo[4,5-b]pyridin-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 10527264) has the molecular formula C24H20N4O3S and a molecular weight of 444.52 g/mol. Its IUPAC name is 5-[[4-[(3-methyl-5-phenylimidazo[4,5-b]pyridin-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[(3-methyl-5-phenylimidazo[4,5-b]pyridin-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10527264 |
| Molecular Formula | C24H20N4O3S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 5-[[4-[(3-methyl-5-phenylimidazo[4,5-b]pyridin-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cn1c(COc2ccc(CC3SC(=O)NC3=O)cc2)nc2ccc(-c3ccccc3)nc21 |
| InChI | InChI=1S/C24H20N4O3S/c1-28-21(25-19-12-11-18(26-22(19)28)16-5-3-2-4-6-16)14-31-17-9-7-15(8-10-17)13-20-23(29)27-24(30)32-20/h2-12,20H,13-14H2,1H3,(H,27,29,30) |
| InChIKey | VAXPHAUJUYIUHV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|