C28H44O4 — CID 10527282
6-[(1R)-1-[(1S,3aR,7aS)-4-[3,4-bis(hydroxymethyl)phenyl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-1-yl]ethoxy]-3-ethylhexan-3-ol (PubChem CID 10527282) has the molecular formula C28H44O4 and a molecular weight of 444.66 g/mol. Its IUPAC name is 6-[(1R)-1-[(1S,3aR,7aS)-4-[3,4-bis(hydroxymethyl)phenyl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-1-yl]ethoxy]-3-ethylhexan-3-ol.
| Compound Name | 6-[(1R)-1-[(1S,3aR,7aS)-4-[3,4-bis(hydroxymethyl)phenyl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-1-yl]ethoxy]-3-ethylhexan-3-ol |
|---|---|
| PubChem CID | 10527282 |
| Molecular Formula | C28H44O4 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | 6-[(1R)-1-[(1S,3aR,7aS)-4-[3,4-bis(hydroxymethyl)phenyl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-1-yl]ethoxy]-3-ethylhexan-3-ol |
| SMILES | CCC(O)(CC)CCCO[C@H](C)[C@H]1CC[C@H]2C(c3ccc(CO)c(CO)c3)=CCC[C@]12C |
| InChI | InChI=1S/C28H44O4/c1-5-28(31,6-2)15-8-16-32-20(3)25-12-13-26-24(9-7-14-27(25,26)4)21-10-11-22(18-29)23(17-21)19-30/h9-11,17,20,25-26,29-31H,5-8,12-16,18-19H2,1-4H3/t20-,25-,26+,27-/m1/s1 |
| InChIKey | KXEBNHDSCXBBIG-YBJJANMISA-N |
| XLogP | 5.62 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|