C20H31NO10 — CID 10527304
[(2R,4aR,6R,7R,7aR)-6-[(1R,2R)-1,2-diacetyloxy-3-(diethylamino)-3-oxopropyl]-2-methyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-yl] acetate (PubChem CID 10527304) has the molecular formula C20H31NO10 and a molecular weight of 445.47 g/mol. Its IUPAC name is [(2R,4aR,6R,7R,7aR)-6-[(1R,2R)-1,2-diacetyloxy-3-(diethylamino)-3-oxopropyl]-2-methyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-yl] acetate.
| Compound Name | [(2R,4aR,6R,7R,7aR)-6-[(1R,2R)-1,2-diacetyloxy-3-(diethylamino)-3-oxopropyl]-2-methyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-yl] acetate |
|---|---|
| PubChem CID | 10527304 |
| Molecular Formula | C20H31NO10 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | [(2R,4aR,6R,7R,7aR)-6-[(1R,2R)-1,2-diacetyloxy-3-(diethylamino)-3-oxopropyl]-2-methyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-yl] acetate |
| SMILES | CCN(CC)C(=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1O[C@@H]2CO[C@@H](C)O[C@H]2[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H31NO10/c1-7-21(8-2)20(25)19(29-12(5)24)18(28-11(4)23)17-16(27-10(3)22)15-14(31-17)9-26-13(6)30-15/h13-19H,7-9H2,1-6H3/t13-,14-,15-,16+,17-,18-,19-/m1/s1 |
| InChIKey | ALRMNFIUZRZFGQ-UDVZFCQKSA-N |
| XLogP | 0.18 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|