C11H24N2O2 — CID 105273352
[2-methoxy-3,3-dimethyl-1-(oxolan-3-yl)butyl]hydrazine (PubChem CID 105273352) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is [2-methoxy-3,3-dimethyl-1-(oxolan-3-yl)butyl]hydrazine.
| Compound Name | [2-methoxy-3,3-dimethyl-1-(oxolan-3-yl)butyl]hydrazine |
|---|---|
| PubChem CID | 105273352 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | [2-methoxy-3,3-dimethyl-1-(oxolan-3-yl)butyl]hydrazine |
| SMILES | COC(C(NN)C1CCOC1)C(C)(C)C |
| InChI | InChI=1S/C11H24N2O2/c1-11(2,3)10(14-4)9(13-12)8-5-6-15-7-8/h8-10,13H,5-7,12H2,1-4H3 |
| InChIKey | GHFPWUHPQLHDED-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|