C12H25F3N2O — CID 105273730
(3-ethoxy-8,8,8-trifluoro-2,2-dimethyloctan-4-yl)hydrazine (PubChem CID 105273730) has the molecular formula C12H25F3N2O and a molecular weight of 270.34 g/mol. Its IUPAC name is (3-ethoxy-8,8,8-trifluoro-2,2-dimethyloctan-4-yl)hydrazine.
| Compound Name | (3-ethoxy-8,8,8-trifluoro-2,2-dimethyloctan-4-yl)hydrazine |
|---|---|
| PubChem CID | 105273730 |
| Molecular Formula | C12H25F3N2O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | (3-ethoxy-8,8,8-trifluoro-2,2-dimethyloctan-4-yl)hydrazine |
| SMILES | CCOC(C(CCCC(F)(F)F)NN)C(C)(C)C |
| InChI | InChI=1S/C12H25F3N2O/c1-5-18-10(11(2,3)4)9(17-16)7-6-8-12(13,14)15/h9-10,17H,5-8,16H2,1-4H3 |
| InChIKey | YRLAVWQLQMZYRQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|