C30H26NOP — CID 10527400
[2-[(3aR,8bS)-4,4-dimethyl-3a,8b-dihydroindeno[2,1-d][1,3]oxazol-2-yl]phenyl]-diphenylphosphane (PubChem CID 10527400) has the molecular formula C30H26NOP and a molecular weight of 447.52 g/mol. Its IUPAC name is [2-[(3aR,8bS)-4,4-dimethyl-3a,8b-dihydroindeno[2,1-d][1,3]oxazol-2-yl]phenyl]-diphenylphosphane.
| Compound Name | [2-[(3aR,8bS)-4,4-dimethyl-3a,8b-dihydroindeno[2,1-d][1,3]oxazol-2-yl]phenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 10527400 |
| Molecular Formula | C30H26NOP |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | [2-[(3aR,8bS)-4,4-dimethyl-3a,8b-dihydroindeno[2,1-d][1,3]oxazol-2-yl]phenyl]-diphenylphosphane |
| SMILES | CC1(C)c2ccccc2[C@@H]2OC(c3ccccc3P(c3ccccc3)c3ccccc3)=N[C@@H]21 |
| InChI | InChI=1S/C30H26NOP/c1-30(2)25-19-11-9-17-23(25)27-28(30)31-29(32-27)24-18-10-12-20-26(24)33(21-13-5-3-6-14-21)22-15-7-4-8-16-22/h3-20,27-28H,1-2H3/t27-,28-/m0/s1 |
| InChIKey | XLJCSKHVWKPAMV-NSOVKSMOSA-N |
| XLogP | 5.62 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|