About (5-ethoxy-1,1,1-trifluoro-5-methylheptan-4-yl)hydrazine
(5-ethoxy-1,1,1-trifluoro-5-methylheptan-4-yl)hydrazine (PubChem CID 105274628) has the molecular formula C10H21F3N2O
and a molecular weight of 242.28 g/mol. Its IUPAC name is (5-ethoxy-1,1,1-trifluoro-5-methylheptan-4-yl)hydrazine.
Molecular Properties
| Compound Name | (5-ethoxy-1,1,1-trifluoro-5-methylheptan-4-yl)hydrazine |
| PubChem CID | 105274628 |
| Molecular Formula | C10H21F3N2O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | (5-ethoxy-1,1,1-trifluoro-5-methylheptan-4-yl)hydrazine |
| SMILES | CCOC(C)(CC)C(CCC(F)(F)F)NN |
| InChI | InChI=1S/C10H21F3N2O/c1-4-9(3,16-5-2)8(15-14)6-7-10(11,12)13/h8,15H,4-7,14H2,1-3H3 |
| InChIKey | ZPYSKXMKAMPBBS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-ethoxy-1,1,1-trifluoro-5-methylheptan-4-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethoxy-1,1,1-trifluoro-5-methylheptan-4-yl)hydrazine?
The IUPAC name of (5-ethoxy-1,1,1-trifluoro-5-methylheptan-4-yl)hydrazine (CID 105274628) is (5-ethoxy-1,1,1-trifluoro-5-methylheptan-4-yl)hydrazine.
What is the SMILES notation for (5-ethoxy-1,1,1-trifluoro-5-methylheptan-4-yl)hydrazine?
The canonical SMILES for (5-ethoxy-1,1,1-trifluoro-5-methylheptan-4-yl)hydrazine is CCOC(C)(CC)C(CCC(F)(F)F)NN.
What is the InChIKey of (5-ethoxy-1,1,1-trifluoro-5-methylheptan-4-yl)hydrazine?
The InChIKey is ZPYSKXMKAMPBBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21F3N2O/c1-4-9(3,16-5-2)8(15-14)6-7-10(11,12)13/h8,15H,4-7,14H2,1-3H3.
What are the key properties of (5-ethoxy-1,1,1-trifluoro-5-methylheptan-4-yl)hydrazine?
(5-ethoxy-1,1,1-trifluoro-5-methylheptan-4-yl)hydrazine has a molecular weight of 242.28 g/mol, XLogP of 2.37, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethoxy-1,1,1-trifluoro-5-methylheptan-4-yl)hydrazine is sourced from PubChem (CID 105274628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).