C12H22N4O2 — CID 105274810
[2-ethoxy-1-(3-methoxypyrazin-2-yl)-2-methylbutyl]hydrazine (PubChem CID 105274810) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is [2-ethoxy-1-(3-methoxypyrazin-2-yl)-2-methylbutyl]hydrazine.
| Compound Name | [2-ethoxy-1-(3-methoxypyrazin-2-yl)-2-methylbutyl]hydrazine |
|---|---|
| PubChem CID | 105274810 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | [2-ethoxy-1-(3-methoxypyrazin-2-yl)-2-methylbutyl]hydrazine |
| SMILES | CCOC(C)(CC)C(NN)c1nccnc1OC |
| InChI | InChI=1S/C12H22N4O2/c1-5-12(3,18-6-2)10(16-13)9-11(17-4)15-8-7-14-9/h7-8,10,16H,5-6,13H2,1-4H3 |
| InChIKey | FFJFCZCIKJGMDM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|