C27H52OSi2 — CID 10527486
trimethyl-[(3Z,5R,6R,7E,9S)-3,5,7,9-tetramethyl-6-tri(propan-2-yl)silyloxyundeca-3,7-dien-1-ynyl]silane (PubChem CID 10527486) has the molecular formula C27H52OSi2 and a molecular weight of 448.88 g/mol. Its IUPAC name is trimethyl-[(3Z,5R,6R,7E,9S)-3,5,7,9-tetramethyl-6-tri(propan-2-yl)silyloxyundeca-3,7-dien-1-ynyl]silane.
| Compound Name | trimethyl-[(3Z,5R,6R,7E,9S)-3,5,7,9-tetramethyl-6-tri(propan-2-yl)silyloxyundeca-3,7-dien-1-ynyl]silane |
|---|---|
| PubChem CID | 10527486 |
| Molecular Formula | C27H52OSi2 |
| Molecular Weight | 448.88 g/mol |
| Exact Mass | 448.36 |
| IUPAC Name | trimethyl-[(3Z,5R,6R,7E,9S)-3,5,7,9-tetramethyl-6-tri(propan-2-yl)silyloxyundeca-3,7-dien-1-ynyl]silane |
| SMILES | CC[C@H](C)/C=C(\C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)/C=C(/C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C27H52OSi2/c1-15-23(8)18-25(10)27(26(11)19-24(9)16-17-29(12,13)14)28-30(20(2)3,21(4)5)22(6)7/h18-23,26-27H,15H2,1-14H3/b24-19-,25-18+/t23-,26+,27-/m0/s1 |
| InChIKey | BVJRPFRREUQDQD-OSOFXNNESA-N |
| XLogP | 9.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.88 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|