About octyl 3-[2,6-di(propan-2-yl)anilino]-3-oxo-2-phenylpropanoate
octyl 3-[2,6-di(propan-2-yl)anilino]-3-oxo-2-phenylpropanoate (PubChem CID 10527599) has the molecular formula C29H41NO3
and a molecular weight of 451.65 g/mol. Its IUPAC name is octyl 3-[2,6-di(propan-2-yl)anilino]-3-oxo-2-phenylpropanoate.
Molecular Properties
| Compound Name | octyl 3-[2,6-di(propan-2-yl)anilino]-3-oxo-2-phenylpropanoate |
| PubChem CID | 10527599 |
| Molecular Formula | C29H41NO3 |
| Molecular Weight | 451.65 g/mol |
| Exact Mass | 451.31 |
| IUPAC Name | octyl 3-[2,6-di(propan-2-yl)anilino]-3-oxo-2-phenylpropanoate |
| SMILES | CCCCCCCCOC(=O)C(C(=O)Nc1c(C(C)C)cccc1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C29H41NO3/c1-6-7-8-9-10-14-20-33-29(32)26(23-16-12-11-13-17-23)28(31)30-27-24(21(2)3)18-15-19-25(27)22(4)5/h11-13,15-19,21-22,26H,6-10,14,20H2,1-5H3,(H,30,31) |
| InChIKey | ZRFDPODCBFFQAS-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.65 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze octyl 3-[2,6-di(propan-2-yl)anilino]-3-oxo-2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octyl 3-[2,6-di(propan-2-yl)anilino]-3-oxo-2-phenylpropanoate?
The IUPAC name of octyl 3-[2,6-di(propan-2-yl)anilino]-3-oxo-2-phenylpropanoate (CID 10527599) is octyl 3-[2,6-di(propan-2-yl)anilino]-3-oxo-2-phenylpropanoate.
What is the SMILES notation for octyl 3-[2,6-di(propan-2-yl)anilino]-3-oxo-2-phenylpropanoate?
The canonical SMILES for octyl 3-[2,6-di(propan-2-yl)anilino]-3-oxo-2-phenylpropanoate is CCCCCCCCOC(=O)C(C(=O)Nc1c(C(C)C)cccc1C(C)C)c1ccccc1.
What is the InChIKey of octyl 3-[2,6-di(propan-2-yl)anilino]-3-oxo-2-phenylpropanoate?
The InChIKey is ZRFDPODCBFFQAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H41NO3/c1-6-7-8-9-10-14-20-33-29(32)26(23-16-12-11-13-17-23)28(31)30-27-24(21(2)3)18-15-19-25(27)22(4)5/h11-13,15-19,21-22,26H,6-10,14,20H2,1-5H3,(H,30,31).
What are the key properties of octyl 3-[2,6-di(propan-2-yl)anilino]-3-oxo-2-phenylpropanoate?
octyl 3-[2,6-di(propan-2-yl)anilino]-3-oxo-2-phenylpropanoate has a molecular weight of 451.65 g/mol, XLogP of 7.56, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octyl 3-[2,6-di(propan-2-yl)anilino]-3-oxo-2-phenylpropanoate is sourced from PubChem (CID 10527599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).