C20H36O7P2 — CID 10527616
[dideuterio-[6-[(3Z)-4,8-dimethylnona-3,7-dienyl]-2,6-dimethylcyclohexen-1-yl]methyl] phosphono hydrogen phosphate (PubChem CID 10527616) has the molecular formula C20H36O7P2 and a molecular weight of 452.46 g/mol. Its IUPAC name is [dideuterio-[6-[(3Z)-4,8-dimethylnona-3,7-dienyl]-2,6-dimethylcyclohexen-1-yl]methyl] phosphono hydrogen phosphate.
| Compound Name | [dideuterio-[6-[(3Z)-4,8-dimethylnona-3,7-dienyl]-2,6-dimethylcyclohexen-1-yl]methyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 10527616 |
| Molecular Formula | C20H36O7P2 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | [dideuterio-[6-[(3Z)-4,8-dimethylnona-3,7-dienyl]-2,6-dimethylcyclohexen-1-yl]methyl] phosphono hydrogen phosphate |
| SMILES | [2H]C([2H])(OP(=O)(O)OP(=O)(O)O)C1=C(C)CCCC1(C)CC/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C20H36O7P2/c1-16(2)9-6-10-17(3)11-7-13-20(5)14-8-12-18(4)19(20)15-26-29(24,25)27-28(21,22)23/h9,11H,6-8,10,12-15H2,1-5H3,(H,24,25)(H2,21,22,23)/b17-11-/i15D2 |
| InChIKey | WQJFHGQVWRYRPS-PZEGNRRASA-N |
| XLogP | 6.19 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|