C14H27N5O — CID 105276351
[1-(1-ethoxycyclohexyl)-2-(2-ethyl-1,2,4-triazol-3-yl)ethyl]hydrazine (PubChem CID 105276351) has the molecular formula C14H27N5O and a molecular weight of 281.40 g/mol. Its IUPAC name is [1-(1-ethoxycyclohexyl)-2-(2-ethyl-1,2,4-triazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(1-ethoxycyclohexyl)-2-(2-ethyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105276351 |
| Molecular Formula | C14H27N5O |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | [1-(1-ethoxycyclohexyl)-2-(2-ethyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
| SMILES | CCOC1(C(Cc2ncnn2CC)NN)CCCCC1 |
| InChI | InChI=1S/C14H27N5O/c1-3-19-13(16-11-17-19)10-12(18-15)14(20-4-2)8-6-5-7-9-14/h11-12,18H,3-10,15H2,1-2H3 |
| InChIKey | RVZGZKDQTNTGQN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|