C15H26N4O — CID 105276403
3-[(1-ethoxycyclohexyl)-hydrazinylmethyl]-4-methylpyridin-2-amine (PubChem CID 105276403) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is 3-[(1-ethoxycyclohexyl)-hydrazinylmethyl]-4-methylpyridin-2-amine.
| Compound Name | 3-[(1-ethoxycyclohexyl)-hydrazinylmethyl]-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 105276403 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 3-[(1-ethoxycyclohexyl)-hydrazinylmethyl]-4-methylpyridin-2-amine |
| SMILES | CCOC1(C(NN)c2c(C)ccnc2N)CCCCC1 |
| InChI | InChI=1S/C15H26N4O/c1-3-20-15(8-5-4-6-9-15)13(19-17)12-11(2)7-10-18-14(12)16/h7,10,13,19H,3-6,8-9,17H2,1-2H3,(H2,16,18) |
| InChIKey | GJEHJPMQKMUWKR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|