C13H17F3N2O2 — CID 105276457
[(4-methoxyoxan-4-yl)-(2,3,4-trifluorophenyl)methyl]hydrazine (PubChem CID 105276457) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.28 g/mol. Its IUPAC name is [(4-methoxyoxan-4-yl)-(2,3,4-trifluorophenyl)methyl]hydrazine.
| Compound Name | [(4-methoxyoxan-4-yl)-(2,3,4-trifluorophenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105276457 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | [(4-methoxyoxan-4-yl)-(2,3,4-trifluorophenyl)methyl]hydrazine |
| SMILES | COC1(C(NN)c2ccc(F)c(F)c2F)CCOCC1 |
| InChI | InChI=1S/C13H17F3N2O2/c1-19-13(4-6-20-7-5-13)12(18-17)8-2-3-9(14)11(16)10(8)15/h2-3,12,18H,4-7,17H2,1H3 |
| InChIKey | WVXYNUBCZWOFDN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|