C24H39NO7 — CID 10527678
[(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] N-propylcarbamate (PubChem CID 10527678) has the molecular formula C24H39NO7 and a molecular weight of 453.58 g/mol. Its IUPAC name is [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] N-propylcarbamate.
| Compound Name | [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] N-propylcarbamate |
|---|---|
| PubChem CID | 10527678 |
| Molecular Formula | C24H39NO7 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | [(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-6-yl] N-propylcarbamate |
| SMILES | C=C[C@@]1(C)CC(=O)[C@]2(O)[C@@]3(C)[C@@H](O)CCC(C)(C)[C@@H]3[C@H](OC(=O)NCCC)[C@H](O)[C@@]2(C)O1 |
| InChI | InChI=1S/C24H39NO7/c1-8-12-25-19(29)31-16-17-20(3,4)11-10-14(26)22(17,6)24(30)15(27)13-21(5,9-2)32-23(24,7)18(16)28/h9,14,16-18,26,28,30H,2,8,10-13H2,1,3-7H3,(H,25,29)/t14-,16-,17-,18-,21-,22-,23+,24-/m0/s1 |
| InChIKey | MFZGSDFJDLJWIE-PNUNPAGSSA-N |
| XLogP | 2.09 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|