C22H31NO5S2 — CID 10527683
3-[propan-2-yl-(2,4,6-trimethylphenyl)sulfonylamino]propyl 4-methylbenzenesulfonate (PubChem CID 10527683) has the molecular formula C22H31NO5S2 and a molecular weight of 453.63 g/mol. Its IUPAC name is 3-[propan-2-yl-(2,4,6-trimethylphenyl)sulfonylamino]propyl 4-methylbenzenesulfonate.
| Compound Name | 3-[propan-2-yl-(2,4,6-trimethylphenyl)sulfonylamino]propyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10527683 |
| Molecular Formula | C22H31NO5S2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 3-[propan-2-yl-(2,4,6-trimethylphenyl)sulfonylamino]propyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCN(C(C)C)S(=O)(=O)c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C22H31NO5S2/c1-16(2)23(29(24,25)22-19(5)14-18(4)15-20(22)6)12-7-13-28-30(26,27)21-10-8-17(3)9-11-21/h8-11,14-16H,7,12-13H2,1-6H3 |
| InChIKey | UVWBQSGQKHGWKJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|