C15H23BrN2O2 — CID 105276967
[2-(2-bromophenyl)-1-(4-ethoxyoxan-4-yl)ethyl]hydrazine (PubChem CID 105276967) has the molecular formula C15H23BrN2O2 and a molecular weight of 343.26 g/mol. Its IUPAC name is [2-(2-bromophenyl)-1-(4-ethoxyoxan-4-yl)ethyl]hydrazine.
| Compound Name | [2-(2-bromophenyl)-1-(4-ethoxyoxan-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105276967 |
| Molecular Formula | C15H23BrN2O2 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | [2-(2-bromophenyl)-1-(4-ethoxyoxan-4-yl)ethyl]hydrazine |
| SMILES | CCOC1(C(Cc2ccccc2Br)NN)CCOCC1 |
| InChI | InChI=1S/C15H23BrN2O2/c1-2-20-15(7-9-19-10-8-15)14(18-17)11-12-5-3-4-6-13(12)16/h3-6,14,18H,2,7-11,17H2,1H3 |
| InChIKey | AMAAOLRFCRQPHE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|