C13H28N2O3S — CID 105277043
[1-(1-methoxy-4-methylcyclohexyl)-4-methylsulfonylbutyl]hydrazine (PubChem CID 105277043) has the molecular formula C13H28N2O3S and a molecular weight of 292.44 g/mol. Its IUPAC name is [1-(1-methoxy-4-methylcyclohexyl)-4-methylsulfonylbutyl]hydrazine.
| Compound Name | [1-(1-methoxy-4-methylcyclohexyl)-4-methylsulfonylbutyl]hydrazine |
|---|---|
| PubChem CID | 105277043 |
| Molecular Formula | C13H28N2O3S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | [1-(1-methoxy-4-methylcyclohexyl)-4-methylsulfonylbutyl]hydrazine |
| SMILES | COC1(C(CCCS(C)(=O)=O)NN)CCC(C)CC1 |
| InChI | InChI=1S/C13H28N2O3S/c1-11-6-8-13(18-2,9-7-11)12(15-14)5-4-10-19(3,16)17/h11-12,15H,4-10,14H2,1-3H3 |
| InChIKey | LACGTLCEKSWIQV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|