C17H34N2O2 — CID 105277173
[(1-methoxy-4-methylcyclohexyl)-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine (PubChem CID 105277173) has the molecular formula C17H34N2O2 and a molecular weight of 298.47 g/mol. Its IUPAC name is [(1-methoxy-4-methylcyclohexyl)-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine.
| Compound Name | [(1-methoxy-4-methylcyclohexyl)-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105277173 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | [(1-methoxy-4-methylcyclohexyl)-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine |
| SMILES | COC1(C(NN)C2CC(C)(C)OC2(C)C)CCC(C)CC1 |
| InChI | InChI=1S/C17H34N2O2/c1-12-7-9-17(20-6,10-8-12)14(19-18)13-11-15(2,3)21-16(13,4)5/h12-14,19H,7-11,18H2,1-6H3 |
| InChIKey | CFTSULYOWYQWTJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|