C18H36N2O — CID 105277347
[(3,4-dimethylcyclohexyl)-(1-ethoxy-4-methylcyclohexyl)methyl]hydrazine (PubChem CID 105277347) has the molecular formula C18H36N2O and a molecular weight of 296.50 g/mol. Its IUPAC name is [(3,4-dimethylcyclohexyl)-(1-ethoxy-4-methylcyclohexyl)methyl]hydrazine.
| Compound Name | [(3,4-dimethylcyclohexyl)-(1-ethoxy-4-methylcyclohexyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105277347 |
| Molecular Formula | C18H36N2O |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.28 |
| IUPAC Name | [(3,4-dimethylcyclohexyl)-(1-ethoxy-4-methylcyclohexyl)methyl]hydrazine |
| SMILES | CCOC1(C(NN)C2CCC(C)C(C)C2)CCC(C)CC1 |
| InChI | InChI=1S/C18H36N2O/c1-5-21-18(10-8-13(2)9-11-18)17(20-19)16-7-6-14(3)15(4)12-16/h13-17,20H,5-12,19H2,1-4H3 |
| InChIKey | URUFZHIJZCXYJH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|