C13H26N2O — CID 105277517
1-(1-methoxy-3-methylcyclohexyl)pent-4-enylhydrazine (PubChem CID 105277517) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-(1-methoxy-3-methylcyclohexyl)pent-4-enylhydrazine.
| Compound Name | 1-(1-methoxy-3-methylcyclohexyl)pent-4-enylhydrazine |
|---|---|
| PubChem CID | 105277517 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 1-(1-methoxy-3-methylcyclohexyl)pent-4-enylhydrazine |
| SMILES | C=CCCC(NN)C1(OC)CCCC(C)C1 |
| InChI | InChI=1S/C13H26N2O/c1-4-5-8-12(15-14)13(16-3)9-6-7-11(2)10-13/h4,11-12,15H,1,5-10,14H2,2-3H3 |
| InChIKey | YPLSPNZCNNWCGO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|