C17H33IO4Si — CID 10527781
(4S,5R,6R)-4-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-6-[(1R)-1-iodopropyl]-5-methyl-1,3-dioxan-2-one (PubChem CID 10527781) has the molecular formula C17H33IO4Si and a molecular weight of 456.44 g/mol. Its IUPAC name is (4S,5R,6R)-4-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-6-[(1R)-1-iodopropyl]-5-methyl-1,3-dioxan-2-one.
| Compound Name | (4S,5R,6R)-4-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-6-[(1R)-1-iodopropyl]-5-methyl-1,3-dioxan-2-one |
|---|---|
| PubChem CID | 10527781 |
| Molecular Formula | C17H33IO4Si |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | (4S,5R,6R)-4-[(2R)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-6-[(1R)-1-iodopropyl]-5-methyl-1,3-dioxan-2-one |
| SMILES | CC[C@@H](I)[C@@H]1OC(=O)O[C@@H]([C@H](C)CO[Si](C)(C)C(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C17H33IO4Si/c1-9-13(18)15-12(3)14(21-16(19)22-15)11(2)10-20-23(7,8)17(4,5)6/h11-15H,9-10H2,1-8H3/t11-,12-,13-,14+,15-/m1/s1 |
| InChIKey | CDCVWEYIFFOFIP-ARILJUKYSA-N |
| XLogP | 5.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|