About [1-(1-methoxy-4,4-dimethylcyclohexyl)-2-(oxan-4-yl)ethyl]hydrazine
[1-(1-methoxy-4,4-dimethylcyclohexyl)-2-(oxan-4-yl)ethyl]hydrazine (PubChem CID 105277972) has the molecular formula C16H32N2O2
and a molecular weight of 284.44 g/mol. Its IUPAC name is [1-(1-methoxy-4,4-dimethylcyclohexyl)-2-(oxan-4-yl)ethyl]hydrazine.
Molecular Properties
| Compound Name | [1-(1-methoxy-4,4-dimethylcyclohexyl)-2-(oxan-4-yl)ethyl]hydrazine |
| PubChem CID | 105277972 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | [1-(1-methoxy-4,4-dimethylcyclohexyl)-2-(oxan-4-yl)ethyl]hydrazine |
| SMILES | COC1(C(CC2CCOCC2)NN)CCC(C)(C)CC1 |
| InChI | InChI=1S/C16H32N2O2/c1-15(2)6-8-16(19-3,9-7-15)14(18-17)12-13-4-10-20-11-5-13/h13-14,18H,4-12,17H2,1-3H3 |
| InChIKey | REBAXZVGYIMJKB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(1-methoxy-4,4-dimethylcyclohexyl)-2-(oxan-4-yl)ethyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1-methoxy-4,4-dimethylcyclohexyl)-2-(oxan-4-yl)ethyl]hydrazine?
The IUPAC name of [1-(1-methoxy-4,4-dimethylcyclohexyl)-2-(oxan-4-yl)ethyl]hydrazine (CID 105277972) is [1-(1-methoxy-4,4-dimethylcyclohexyl)-2-(oxan-4-yl)ethyl]hydrazine.
What is the SMILES notation for [1-(1-methoxy-4,4-dimethylcyclohexyl)-2-(oxan-4-yl)ethyl]hydrazine?
The canonical SMILES for [1-(1-methoxy-4,4-dimethylcyclohexyl)-2-(oxan-4-yl)ethyl]hydrazine is COC1(C(CC2CCOCC2)NN)CCC(C)(C)CC1.
What is the InChIKey of [1-(1-methoxy-4,4-dimethylcyclohexyl)-2-(oxan-4-yl)ethyl]hydrazine?
The InChIKey is REBAXZVGYIMJKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2O2/c1-15(2)6-8-16(19-3,9-7-15)14(18-17)12-13-4-10-20-11-5-13/h13-14,18H,4-12,17H2,1-3H3.
What are the key properties of [1-(1-methoxy-4,4-dimethylcyclohexyl)-2-(oxan-4-yl)ethyl]hydrazine?
[1-(1-methoxy-4,4-dimethylcyclohexyl)-2-(oxan-4-yl)ethyl]hydrazine has a molecular weight of 284.44 g/mol, XLogP of 2.62, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1-methoxy-4,4-dimethylcyclohexyl)-2-(oxan-4-yl)ethyl]hydrazine is sourced from PubChem (CID 105277972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).