C23H21N7O2S — CID 10527917
2-[4-[(5-methyl-1,3-diphenylpyrazol-4-yl)diazenyl]phenyl]sulfonylguanidine (PubChem CID 10527917) has the molecular formula C23H21N7O2S and a molecular weight of 459.54 g/mol. Its IUPAC name is 2-[4-[(5-methyl-1,3-diphenylpyrazol-4-yl)diazenyl]phenyl]sulfonylguanidine.
| Compound Name | 2-[4-[(5-methyl-1,3-diphenylpyrazol-4-yl)diazenyl]phenyl]sulfonylguanidine |
|---|---|
| PubChem CID | 10527917 |
| Molecular Formula | C23H21N7O2S |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 2-[4-[(5-methyl-1,3-diphenylpyrazol-4-yl)diazenyl]phenyl]sulfonylguanidine |
| SMILES | Cc1c(/N=N/c2ccc(S(=O)(=O)N=C(N)N)cc2)c(-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C23H21N7O2S/c1-16-21(27-26-18-12-14-20(15-13-18)33(31,32)29-23(24)25)22(17-8-4-2-5-9-17)28-30(16)19-10-6-3-7-11-19/h2-15H,1H3,(H4,24,25,29)/b27-26+ |
| InChIKey | RYELNLRRUXHAPB-CYYJNZCTSA-N |
| XLogP | 4.23 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|