C24H37BO6Si — CID 10527946
dipropan-2-yl (4R,5R)-2-[(E)-3-[dimethyl-(2,4,6-trimethylphenyl)silyl]prop-2-enyl]-1,3,2-dioxaborolane-4,5-dicarboxylate (PubChem CID 10527946) has the molecular formula C24H37BO6Si and a molecular weight of 460.45 g/mol. Its IUPAC name is dipropan-2-yl (4R,5R)-2-[(E)-3-[dimethyl-(2,4,6-trimethylphenyl)silyl]prop-2-enyl]-1,3,2-dioxaborolane-4,5-dicarboxylate.
| Compound Name | dipropan-2-yl (4R,5R)-2-[(E)-3-[dimethyl-(2,4,6-trimethylphenyl)silyl]prop-2-enyl]-1,3,2-dioxaborolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 10527946 |
| Molecular Formula | C24H37BO6Si |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | dipropan-2-yl (4R,5R)-2-[(E)-3-[dimethyl-(2,4,6-trimethylphenyl)silyl]prop-2-enyl]-1,3,2-dioxaborolane-4,5-dicarboxylate |
| SMILES | Cc1cc(C)c([Si](C)(C)/C=C/CB2O[C@@H](C(=O)OC(C)C)[C@H](C(=O)OC(C)C)O2)c(C)c1 |
| InChI | InChI=1S/C24H37BO6Si/c1-15(2)28-23(26)20-21(24(27)29-16(3)4)31-25(30-20)11-10-12-32(8,9)22-18(6)13-17(5)14-19(22)7/h10,12-16,20-21H,11H2,1-9H3/b12-10+/t20-,21-/m1/s1 |
| InChIKey | PIMMVIQCAAEFRE-LTVLFBMZSA-N |
| XLogP | 3.80 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|