C15H25BrN2 — CID 105279490
[1-(4-bromo-3,5-dimethylphenyl)-3-methylhexyl]hydrazine (PubChem CID 105279490) has the molecular formula C15H25BrN2 and a molecular weight of 313.28 g/mol. Its IUPAC name is [1-(4-bromo-3,5-dimethylphenyl)-3-methylhexyl]hydrazine.
| Compound Name | [1-(4-bromo-3,5-dimethylphenyl)-3-methylhexyl]hydrazine |
|---|---|
| PubChem CID | 105279490 |
| Molecular Formula | C15H25BrN2 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | [1-(4-bromo-3,5-dimethylphenyl)-3-methylhexyl]hydrazine |
| SMILES | CCCC(C)CC(NN)c1cc(C)c(Br)c(C)c1 |
| InChI | InChI=1S/C15H25BrN2/c1-5-6-10(2)7-14(18-17)13-8-11(3)15(16)12(4)9-13/h8-10,14,18H,5-7,17H2,1-4H3 |
| InChIKey | WXZOKZLYQYFOTN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|