C26H28N4O4 — CID 10527958
(3S)-3-[1-tert-butyl-7-[2-(4-carbamimidoylphenyl)ethynyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]butanoic acid (PubChem CID 10527958) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is (3S)-3-[1-tert-butyl-7-[2-(4-carbamimidoylphenyl)ethynyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]butanoic acid.
| Compound Name | (3S)-3-[1-tert-butyl-7-[2-(4-carbamimidoylphenyl)ethynyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 10527958 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | (3S)-3-[1-tert-butyl-7-[2-(4-carbamimidoylphenyl)ethynyl]-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]butanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(C#Cc2ccc3c(c2)C(=O)N([C@@H](C)CC(=O)O)CC(=O)N3C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H28N4O4/c1-16(13-23(32)33)29-15-22(31)30(26(2,3)4)21-12-9-18(14-20(21)25(29)34)6-5-17-7-10-19(11-8-17)24(27)28/h7-12,14,16H,13,15H2,1-4H3,(H3,27,28)(H,32,33)/t16-/m0/s1 |
| InChIKey | BXPUXQXIESIGAE-INIZCTEOSA-N |
| XLogP | 2.82 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|