C15H21N3 — CID 105279714
[2,2-dimethyl-1-(4-methylquinolin-2-yl)propyl]hydrazine (PubChem CID 105279714) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is [2,2-dimethyl-1-(4-methylquinolin-2-yl)propyl]hydrazine.
| Compound Name | [2,2-dimethyl-1-(4-methylquinolin-2-yl)propyl]hydrazine |
|---|---|
| PubChem CID | 105279714 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | [2,2-dimethyl-1-(4-methylquinolin-2-yl)propyl]hydrazine |
| SMILES | Cc1cc(C(NN)C(C)(C)C)nc2ccccc12 |
| InChI | InChI=1S/C15H21N3/c1-10-9-13(14(18-16)15(2,3)4)17-12-8-6-5-7-11(10)12/h5-9,14,18H,16H2,1-4H3 |
| InChIKey | SWOXJNJALRDHLN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|