C14H20ClN5 — CID 105279877
[2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-1-(4-methyl-3-pyridinyl)ethyl]hydrazine (PubChem CID 105279877) has the molecular formula C14H20ClN5 and a molecular weight of 293.80 g/mol. Its IUPAC name is [2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-1-(4-methyl-3-pyridinyl)ethyl]hydrazine.
| Compound Name | [2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-1-(4-methyl-3-pyridinyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105279877 |
| Molecular Formula | C14H20ClN5 |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | [2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-1-(4-methyl-3-pyridinyl)ethyl]hydrazine |
| SMILES | CCc1nn(C)c(CC(NN)c2cnccc2C)c1Cl |
| InChI | InChI=1S/C14H20ClN5/c1-4-11-14(15)13(20(3)19-11)7-12(18-16)10-8-17-6-5-9(10)2/h5-6,8,12,18H,4,7,16H2,1-3H3 |
| InChIKey | OTVDCNUPIQOKBW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|