C10H10Cl2N4S — CID 105281260
[(3,4-dichlorophenyl)-(4-methylthiadiazol-5-yl)methyl]hydrazine (PubChem CID 105281260) has the molecular formula C10H10Cl2N4S and a molecular weight of 289.19 g/mol. Its IUPAC name is [(3,4-dichlorophenyl)-(4-methylthiadiazol-5-yl)methyl]hydrazine.
| Compound Name | [(3,4-dichlorophenyl)-(4-methylthiadiazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105281260 |
| Molecular Formula | C10H10Cl2N4S |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | [(3,4-dichlorophenyl)-(4-methylthiadiazol-5-yl)methyl]hydrazine |
| SMILES | Cc1nnsc1C(NN)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H10Cl2N4S/c1-5-10(17-16-15-5)9(14-13)6-2-3-7(11)8(12)4-6/h2-4,9,14H,13H2,1H3 |
| InChIKey | LDXUUBMXHVXNBU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|