C18H20Cl3N3O5 — CID 10528131
[(3S,4S,5S)-4-acetyloxy-5-[4,5,6-trichloro-2-(propan-2-ylamino)benzimidazol-1-yl]oxolan-3-yl] acetate (PubChem CID 10528131) has the molecular formula C18H20Cl3N3O5 and a molecular weight of 464.73 g/mol. Its IUPAC name is [(3S,4S,5S)-4-acetyloxy-5-[4,5,6-trichloro-2-(propan-2-ylamino)benzimidazol-1-yl]oxolan-3-yl] acetate.
| Compound Name | [(3S,4S,5S)-4-acetyloxy-5-[4,5,6-trichloro-2-(propan-2-ylamino)benzimidazol-1-yl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 10528131 |
| Molecular Formula | C18H20Cl3N3O5 |
| Molecular Weight | 464.73 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | [(3S,4S,5S)-4-acetyloxy-5-[4,5,6-trichloro-2-(propan-2-ylamino)benzimidazol-1-yl]oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](OC(C)=O)CO[C@@H]1n1c(NC(C)C)nc2c(Cl)c(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C18H20Cl3N3O5/c1-7(2)22-18-23-15-11(5-10(19)13(20)14(15)21)24(18)17-16(29-9(4)26)12(6-27-17)28-8(3)25/h5,7,12,16-17H,6H2,1-4H3,(H,22,23)/t12-,16-,17-/m0/s1 |
| InChIKey | LKFVBWZQHIPLLG-ZLIFDBKOSA-N |
| XLogP | 4.21 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.73 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|