C13H16N2 — CID 105281555
1-(2-phenylcyclopropyl)but-3-ynylhydrazine (PubChem CID 105281555) has the molecular formula C13H16N2 and a molecular weight of 200.29 g/mol. Its IUPAC name is 1-(2-phenylcyclopropyl)but-3-ynylhydrazine.
| Compound Name | 1-(2-phenylcyclopropyl)but-3-ynylhydrazine |
|---|---|
| PubChem CID | 105281555 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 1-(2-phenylcyclopropyl)but-3-ynylhydrazine |
| SMILES | C#CCC(NN)C1CC1c1ccccc1 |
| InChI | InChI=1S/C13H16N2/c1-2-6-13(15-14)12-9-11(12)10-7-4-3-5-8-10/h1,3-5,7-8,11-13,15H,6,9,14H2 |
| InChIKey | XLFOJFRGLBLJLA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|