C15H19FN4 — CID 105284782
[1-(3-ethyl-6-methylpyridazin-4-yl)-2-(2-fluorophenyl)ethyl]hydrazine (PubChem CID 105284782) has the molecular formula C15H19FN4 and a molecular weight of 274.34 g/mol. Its IUPAC name is [1-(3-ethyl-6-methylpyridazin-4-yl)-2-(2-fluorophenyl)ethyl]hydrazine.
| Compound Name | [1-(3-ethyl-6-methylpyridazin-4-yl)-2-(2-fluorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105284782 |
| Molecular Formula | C15H19FN4 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | [1-(3-ethyl-6-methylpyridazin-4-yl)-2-(2-fluorophenyl)ethyl]hydrazine |
| SMILES | CCc1nnc(C)cc1C(Cc1ccccc1F)NN |
| InChI | InChI=1S/C15H19FN4/c1-3-14-12(8-10(2)19-20-14)15(18-17)9-11-6-4-5-7-13(11)16/h4-8,15,18H,3,9,17H2,1-2H3 |
| InChIKey | BJOSRROSYQZQMG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|