C14H13BrF2N2O — CID 105285804
[(4-bromo-2,6-difluorophenyl)-(2-methoxyphenyl)methyl]hydrazine (PubChem CID 105285804) has the molecular formula C14H13BrF2N2O and a molecular weight of 343.17 g/mol. Its IUPAC name is [(4-bromo-2,6-difluorophenyl)-(2-methoxyphenyl)methyl]hydrazine.
| Compound Name | [(4-bromo-2,6-difluorophenyl)-(2-methoxyphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105285804 |
| Molecular Formula | C14H13BrF2N2O |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | [(4-bromo-2,6-difluorophenyl)-(2-methoxyphenyl)methyl]hydrazine |
| SMILES | COc1ccccc1C(NN)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C14H13BrF2N2O/c1-20-12-5-3-2-4-9(12)14(19-18)13-10(16)6-8(15)7-11(13)17/h2-7,14,19H,18H2,1H3 |
| InChIKey | ZXFUQSNAOJDRNL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|